671 lines
18 KiB
Markdown
671 lines
18 KiB
Markdown
---
|
|
title: "Drug Repurposing Reference"
|
|
task: ""
|
|
lineage_type: import
|
|
upstream_source: https://github.com/mims-harvard/ToolUniverse/blob/e2520a96/skills/tooluniverse-drug-repurposing/REFERENCE.md
|
|
upstream_sha: e2520a96
|
|
imported_at: 2026-06-26
|
|
prompt_class: prompt
|
|
upstream_changes: accepted
|
|
author: upstream
|
|
validated: false
|
|
---
|
|
|
|
# Drug Repurposing Reference
|
|
|
|
Detailed tool documentation and API reference for drug repurposing workflows.
|
|
|
|
## ToolUniverse Tools by Category
|
|
|
|
### Disease & Target Discovery Tools
|
|
|
|
#### OpenTargets_get_disease_id_description_by_name
|
|
```python
|
|
disease_info = tu.tools.OpenTargets_get_disease_id_description_by_name(
|
|
diseaseName="Alzheimer's disease"
|
|
)
|
|
# Returns: {'data': {'id': 'EFO_0000249', 'name': '...', 'description': '...'}}
|
|
```
|
|
**Use**: Initial disease lookup, get EFO ID for further queries
|
|
|
|
#### OpenTargets_get_associated_targets_by_disease_efoId
|
|
```python
|
|
targets = tu.tools.OpenTargets_get_associated_targets_by_disease_efoId(
|
|
efoId="EFO_0000249",
|
|
limit=20
|
|
)
|
|
# Returns: List of targets with association scores
|
|
```
|
|
**Use**: Find proteins/genes associated with disease (repurposing targets)
|
|
|
|
#### OpenTargets_get_diseases_by_target_ensemblId
|
|
```python
|
|
diseases = tu.tools.OpenTargets_get_diseases_by_target_ensemblId(
|
|
ensemblId="ENSG00000012048"
|
|
)
|
|
# Returns: Diseases associated with gene/protein
|
|
```
|
|
**Use**: Reverse lookup - find diseases for drug targets (compound-based repurposing)
|
|
|
|
---
|
|
|
|
### Drug Discovery Tools
|
|
|
|
#### drugbank_get_drug_name_and_description_by_target_name
|
|
```python
|
|
drugs = tu.tools.drugbank_get_drug_name_and_description_by_target_name(
|
|
target_name="BACE1"
|
|
)
|
|
# Returns: List of drugs targeting specified protein
|
|
```
|
|
**Use**: Primary tool for finding drugs by target (target-based repurposing)
|
|
|
|
#### drugbank_get_drug_name_and_description_by_indication
|
|
```python
|
|
drugs = tu.tools.drugbank_get_drug_name_and_description_by_indication(
|
|
indication="hypertension"
|
|
)
|
|
# Returns: Drugs approved for specified indication
|
|
```
|
|
**Use**: Find drugs for related indications (indication-based repurposing)
|
|
|
|
#### DGIdb_get_drug_gene_interactions
|
|
```python
|
|
interactions = tu.tools.DGIdb_get_drug_gene_interactions(
|
|
gene_name="APP"
|
|
)
|
|
# Returns: Drug-gene interactions with interaction types
|
|
```
|
|
**Use**: Alternative source for drug-target pairs, includes interaction types
|
|
|
|
#### DGIdb_get_gene_druggability
|
|
```python
|
|
druggability = tu.tools.DGIdb_get_gene_druggability(
|
|
gene_name="APOE"
|
|
)
|
|
# Returns: Druggability assessment and tier
|
|
```
|
|
**Use**: Assess if target is druggable before extensive search
|
|
|
|
#### ChEMBL_search_drugs
|
|
```python
|
|
drugs = tu.tools.ChEMBL_search_drugs(
|
|
query="kinase inhibitor",
|
|
limit=10
|
|
)
|
|
# Returns: ChEMBL drug molecules matching query
|
|
```
|
|
**Use**: Broad drug search, alternative to DrugBank
|
|
|
|
#### ChEMBL_get_drug_mechanisms
|
|
```python
|
|
mechanisms = tu.tools.ChEMBL_get_drug_mechanisms(
|
|
chembl_id="CHEMBL941"
|
|
)
|
|
# Returns: Mechanism of action details
|
|
```
|
|
**Use**: Understand drug mechanism for repurposing rationale
|
|
|
|
---
|
|
|
|
### Drug Information Tools
|
|
|
|
#### drugbank_get_drug_basic_info_by_drug_name_or_id
|
|
```python
|
|
info = tu.tools.drugbank_get_drug_basic_info_by_drug_name_or_id(
|
|
drug_name_or_drugbank_id="metformin"
|
|
)
|
|
# Returns: Basic drug info including approval status, groups, description
|
|
```
|
|
**Use**: Initial drug lookup, verify approval status
|
|
|
|
#### drugbank_get_indications_by_drug_name_or_drugbank_id
|
|
```python
|
|
indications = tu.tools.drugbank_get_indications_by_drug_name_or_drugbank_id(
|
|
drug_name_or_drugbank_id="aspirin"
|
|
)
|
|
# Returns: List of approved indications
|
|
```
|
|
**Use**: Check current uses, identify repurposing opportunities (new indications)
|
|
|
|
#### drugbank_get_targets_by_drug_name_or_drugbank_id
|
|
```python
|
|
targets = tu.tools.drugbank_get_targets_by_drug_name_or_drugbank_id(
|
|
drug_name_or_drugbank_id="imatinib"
|
|
)
|
|
# Returns: Drug targets with accessions
|
|
```
|
|
**Use**: Compound-based repurposing - find all targets for known drug
|
|
|
|
#### drugbank_get_pharmacology_by_drug_name_or_drugbank_id
|
|
```python
|
|
pharmacology = tu.tools.drugbank_get_pharmacology_by_drug_name_or_drugbank_id(
|
|
drug_name_or_drugbank_id="warfarin"
|
|
)
|
|
# Returns: Mechanism of action, pharmacodynamics, pharmacokinetics
|
|
```
|
|
**Use**: Understand drug mechanism for repurposing rationale
|
|
|
|
#### drugbank_get_pathways_reactions_by_drug_or_id
|
|
```python
|
|
pathways = tu.tools.drugbank_get_pathways_reactions_by_drug_or_id(
|
|
drug_name_or_drugbank_id="statins"
|
|
)
|
|
# Returns: Affected pathways and reactions
|
|
```
|
|
**Use**: Pathway-based repurposing - find drugs affecting similar pathways
|
|
|
|
#### drugbank_get_drug_name_and_description_by_pathway_name
|
|
```python
|
|
drugs = tu.tools.drugbank_get_drug_name_and_description_by_pathway_name(
|
|
pathway_name="cholesterol biosynthesis"
|
|
)
|
|
# Returns: Drugs affecting specified pathway
|
|
```
|
|
**Use**: Find drugs with pathway overlap (network-based repurposing)
|
|
|
|
#### drugbank_get_drug_desc_pharmacology_by_moa
|
|
```python
|
|
drugs = tu.tools.drugbank_get_drug_desc_pharmacology_by_moa(
|
|
mechanism_of_action="receptor antagonist"
|
|
)
|
|
# Returns: Drugs with specified mechanism
|
|
```
|
|
**Use**: Mechanism-based repurposing
|
|
|
|
---
|
|
|
|
### Safety Assessment Tools
|
|
|
|
#### FDA_get_warnings_and_cautions_by_drug_name
|
|
```python
|
|
warnings = tu.tools.FDA_get_warnings_and_cautions_by_drug_name(
|
|
drug_name="aspirin"
|
|
)
|
|
# Returns: FDA warnings, precautions, contraindications
|
|
```
|
|
**Use**: Critical safety assessment before repurposing recommendation
|
|
|
|
#### FDA_get_precautions_by_drug_name
|
|
```python
|
|
precautions = tu.tools.FDA_get_precautions_by_drug_name(
|
|
drug_name="metformin"
|
|
)
|
|
# Returns: Precautions and special populations
|
|
```
|
|
**Use**: Identify patient populations to exclude
|
|
|
|
#### drugbank_get_drug_interactions_by_drug_name_or_id
|
|
```python
|
|
interactions = tu.tools.drugbank_get_drug_interactions_by_drug_name_or_id(
|
|
drug_name_or_id="warfarin"
|
|
)
|
|
# Returns: Drug-drug interactions
|
|
```
|
|
**Use**: Assess interaction risk for new indication (different patient population)
|
|
|
|
#### FAERS_search_reports_by_drug_and_reaction
|
|
```python
|
|
reports = tu.tools.FAERS_search_reports_by_drug_and_reaction(
|
|
drug_name="LIPITOR",
|
|
reaction="myalgia",
|
|
limit=100
|
|
)
|
|
# Returns: Adverse event reports
|
|
```
|
|
**Use**: Real-world safety data, specific adverse events
|
|
|
|
#### FAERS_count_reactions_by_drug_event
|
|
```python
|
|
reactions = tu.tools.FAERS_count_reactions_by_drug_event(
|
|
medicinalproduct="ASPIRIN"
|
|
)
|
|
# Returns: Counts of all reported reactions
|
|
```
|
|
**Use**: Overview of adverse event profile
|
|
|
|
#### FAERS_count_death_related_by_drug
|
|
```python
|
|
deaths = tu.tools.FAERS_count_death_related_by_drug(
|
|
medicinalproduct="FENTANYL"
|
|
)
|
|
# Returns: Death-related adverse event counts
|
|
```
|
|
**Use**: Most serious safety assessment
|
|
|
|
#### FAERS_count_seriousness_by_drug_event
|
|
```python
|
|
seriousness = tu.tools.FAERS_count_seriousness_by_drug_event(
|
|
medicinalproduct="METFORMIN"
|
|
)
|
|
# Returns: Classification of events by seriousness
|
|
```
|
|
**Use**: Stratify adverse events by severity
|
|
|
|
---
|
|
|
|
### Chemical Property Tools
|
|
|
|
#### PubChem_get_CID_by_compound_name
|
|
```python
|
|
cid = tu.tools.PubChem_get_CID_by_compound_name(
|
|
compound_name="aspirin"
|
|
)
|
|
# Returns: PubChem Compound ID
|
|
```
|
|
**Use**: First step for PubChem queries
|
|
|
|
#### PubChem_get_compound_properties_by_CID
|
|
```python
|
|
properties = tu.tools.PubChem_get_compound_properties_by_CID(
|
|
cid=2244
|
|
)
|
|
# Returns: MW, formula, SMILES, LogP, H-bond donors/acceptors
|
|
```
|
|
**Use**: Assess drug-likeness, compare analogs
|
|
|
|
#### PubChem_search_compounds_by_similarity
|
|
```python
|
|
similar = tu.tools.PubChem_search_compounds_by_similarity(
|
|
smiles="CC(=O)Oc1ccccc1C(=O)O",
|
|
threshold=85,
|
|
limit=50
|
|
)
|
|
# Returns: Structurally similar compounds
|
|
```
|
|
**Use**: Structure-based repurposing - find approved drug analogs
|
|
|
|
#### PubChem_get_compound_bioactivity
|
|
```python
|
|
bioactivity = tu.tools.PubChem_get_compound_bioactivity(
|
|
cid=2244
|
|
)
|
|
# Returns: Active/inactive assay counts
|
|
```
|
|
**Use**: Evidence of biological activity
|
|
|
|
#### ChEMBL_search_activities
|
|
```python
|
|
bioactivity = tu.tools.ChEMBL_search_activities(
|
|
chembl_id="CHEMBL25"
|
|
)
|
|
# Returns: Detailed bioactivity data (IC50, EC50, etc.)
|
|
```
|
|
**Use**: Quantitative activity data for target validation
|
|
|
|
---
|
|
|
|
### ADMET Prediction Tools
|
|
|
|
#### ADMETAI_predict_physicochemical_properties
|
|
```python
|
|
admet = tu.tools.ADMETAI_predict_physicochemical_properties(
|
|
smiles="CC(C)Cc1ccc(cc1)C(C)C(O)=O"
|
|
)
|
|
# Returns: Absorption, distribution, metabolism, excretion, toxicity predictions
|
|
```
|
|
**Use**: Predict drug-like properties for candidates, filter early
|
|
|
|
**Important**: Use `use_cache=True` for expensive ML predictions
|
|
|
|
#### ADMETAI_predict_toxicity
|
|
```python
|
|
toxicity = tu.tools.ADMETAI_predict_toxicity(
|
|
smiles=["SMILES1", "SMILES2"]
|
|
)
|
|
# Returns: Toxicity predictions (hERG, hepatotoxicity, etc.)
|
|
```
|
|
**Use**: Safety screening before clinical consideration
|
|
|
|
---
|
|
|
|
### Literature Search Tools
|
|
|
|
#### PubMed_search_articles
|
|
```python
|
|
papers = tu.tools.PubMed_search_articles(
|
|
query="metformin AND Alzheimer's disease",
|
|
max_results=50
|
|
)
|
|
# Returns: PubMed articles with PMIDs, titles, abstracts
|
|
```
|
|
**Use**: Primary literature evidence for repurposing hypothesis
|
|
|
|
#### EuropePMC_search_articles
|
|
```python
|
|
papers = tu.tools.EuropePMC_search_articles(
|
|
query="aspirin AND cancer",
|
|
limit=50
|
|
)
|
|
# Returns: Europe PMC articles (includes preprints)
|
|
```
|
|
**Use**: Alternative/additional literature source
|
|
|
|
#### search_clinical_trials
|
|
```python
|
|
trials = tu.tools.search_clinical_trials(
|
|
condition="COVID-19",
|
|
intervention="hydroxychloroquine"
|
|
)
|
|
# Returns: Clinical trial records
|
|
```
|
|
**Use**: Check existing clinical evidence, identify completed/ongoing trials
|
|
|
|
---
|
|
|
|
### Protein/Target Information Tools
|
|
|
|
#### UniProt_get_entry_by_accession
|
|
```python
|
|
protein = tu.tools.UniProt_get_entry_by_accession(
|
|
accession="P05067"
|
|
)
|
|
# Returns: Detailed protein information
|
|
```
|
|
**Use**: Understand target biology, confirm druggability
|
|
|
|
---
|
|
|
|
## Parameter Guidelines
|
|
|
|
### Query Construction
|
|
|
|
**Drug names**:
|
|
- Use generic names: "aspirin" not "Bayer Aspirin"
|
|
- Lowercase for DrugBank: `drug_name="metformin"`
|
|
- UPPERCASE for FAERS: `medicinalproduct="METFORMIN"`
|
|
|
|
**Disease names**:
|
|
- Use standard terminology: "Alzheimer's disease" not "dementia"
|
|
- Try variations if not found: "breast cancer", "breast carcinoma", "mammary carcinoma"
|
|
|
|
**Gene/Target names**:
|
|
- HUGO nomenclature: "APP" not "Amyloid Precursor Protein"
|
|
- Protein names: "Amyloid beta A4 protein" for UniProt
|
|
- Ensembl IDs: "ENSG00000" format for OpenTargets
|
|
|
|
### Result Limits
|
|
|
|
Recommended limits by tool:
|
|
- `OpenTargets_get_associated_targets_by_disease_efoId`: 20-50 (prioritize by score)
|
|
- `DGIdb_get_drug_gene_interactions`: No limit (returns all)
|
|
- `ChEMBL_search_drugs`: 10-20
|
|
- `PubMed_search_articles`: 50-100 for thorough analysis
|
|
- `FAERS` tools: 100-1000 (statistical analysis)
|
|
- `PubChem_search_compounds_by_similarity`: 50-100
|
|
|
|
### Caching Strategy
|
|
|
|
**Always cache**:
|
|
- ADMET predictions (expensive ML)
|
|
- Literature searches (large results)
|
|
- Drug/protein detail queries (static data)
|
|
|
|
**Don't cache**:
|
|
- FAERS data (updated quarterly)
|
|
- Clinical trials (frequently updated)
|
|
- Real-time safety alerts
|
|
|
|
```python
|
|
# Enable caching globally
|
|
tu = ToolUniverse(use_cache=True)
|
|
|
|
# Or per-call
|
|
result = tu.tools.ADMETAI_predict_physicochemical_properties(smiles="...", use_cache=True)
|
|
```
|
|
|
|
---
|
|
|
|
## Data Structure Patterns
|
|
|
|
### Standard Result Format
|
|
```python
|
|
{
|
|
'data': [...], # Main results (list or dict)
|
|
'meta': {...}, # Metadata (counts, pagination)
|
|
'status': 'success', # Status indicator
|
|
'message': 'Optional message'
|
|
}
|
|
```
|
|
|
|
### OpenTargets Target Object
|
|
```python
|
|
{
|
|
'gene_symbol': 'APP',
|
|
'gene_name': 'Amyloid Precursor Protein',
|
|
'ensembl_id': 'ENSG00000142192',
|
|
'uniprot_id': 'P05067',
|
|
'score': 0.95, # Association score (0-1)
|
|
'data_sources': [...] # Evidence sources
|
|
}
|
|
```
|
|
|
|
### DrugBank Drug Object
|
|
```python
|
|
{
|
|
'drugbank_id': 'DB00945',
|
|
'name': 'Aspirin',
|
|
'description': '...',
|
|
'groups': ['approved', 'vet_approved'],
|
|
'indication': '...',
|
|
'pharmacodynamics': '...',
|
|
'mechanism_of_action': '...',
|
|
'targets': [...]
|
|
}
|
|
```
|
|
|
|
### FAERS Result Format
|
|
```python
|
|
{
|
|
'results': [
|
|
{
|
|
'term': 'NAUSEA',
|
|
'count': 12345
|
|
},
|
|
...
|
|
],
|
|
'meta': {
|
|
'total': 50000,
|
|
'disclaimer': '...'
|
|
}
|
|
}
|
|
```
|
|
|
|
---
|
|
|
|
## Common Patterns & Recipes
|
|
|
|
### Pattern 1: Batch Target Screening
|
|
```python
|
|
# Screen multiple targets efficiently
|
|
targets = ['APP', 'APOE', 'MAPT', 'PSEN1', 'PSEN2']
|
|
|
|
all_drugs = []
|
|
for target in targets:
|
|
drugs = tu.tools.DGIdb_get_drug_gene_interactions(gene_name=target)
|
|
if drugs and 'data' in drugs:
|
|
all_drugs.extend([{**d, 'target': target} for d in drugs['data']])
|
|
|
|
# Deduplicate by drug name
|
|
unique_drugs = {d['drug_name']: d for d in all_drugs}.values()
|
|
```
|
|
|
|
### Pattern 2: Cross-Database Validation
|
|
```python
|
|
# Validate drug-target interaction across databases
|
|
drug = "imatinib"
|
|
target = "ABL1"
|
|
|
|
# Check DrugBank
|
|
db_targets = tu.tools.drugbank_get_targets_by_drug_name_or_drugbank_id(
|
|
drug_name_or_drugbank_id=drug
|
|
)
|
|
db_confirms = any(t['gene_symbol'] == target for t in db_targets.get('data', []))
|
|
|
|
# Check DGIdb
|
|
dgidb = tu.tools.DGIdb_get_drug_gene_interactions(gene_name=target)
|
|
dgidb_confirms = any(d['drug_name'].lower() == drug.lower()
|
|
for d in dgidb.get('data', []))
|
|
|
|
# Check ChEMBL
|
|
chembl_drugs = tu.tools.ChEMBL_search_drugs(query=drug, limit=1)
|
|
if chembl_drugs and 'data' in chembl_drugs:
|
|
chembl_id = chembl_drugs['data'][0]['molecule_chembl_id']
|
|
mechanisms = tu.tools.ChEMBL_get_drug_mechanisms(chembl_id=chembl_id)
|
|
chembl_confirms = any(target in str(m) for m in mechanisms.get('data', []))
|
|
|
|
validation_score = sum([db_confirms, dgidb_confirms, chembl_confirms])
|
|
print(f"Validation: {validation_score}/3 databases confirm {drug}-{target} interaction")
|
|
```
|
|
|
|
### Pattern 3: Safety Signal Detection
|
|
```python
|
|
# Detect safety signals for repurposing
|
|
drug = "THALIDOMIDE"
|
|
|
|
# Get all adverse events
|
|
all_reactions = tu.tools.FAERS_count_reactions_by_drug_event(
|
|
medicinalproduct=drug
|
|
)
|
|
|
|
# Classify by seriousness
|
|
seriousness = tu.tools.FAERS_count_seriousness_by_drug_event(
|
|
medicinalproduct=drug
|
|
)
|
|
|
|
# Get death reports
|
|
deaths = tu.tools.FAERS_count_death_related_by_drug(
|
|
medicinalproduct=drug
|
|
)
|
|
|
|
# Calculate safety score
|
|
total_reports = sum(r['count'] for r in all_reactions.get('results', []))
|
|
death_count = deaths.get('meta', {}).get('total', 0)
|
|
death_ratio = death_count / max(total_reports, 1)
|
|
|
|
if death_ratio > 0.01: # >1% death reports
|
|
print(f"⚠️ HIGH RISK: {death_ratio*100:.2f}% death ratio")
|
|
elif death_ratio > 0.001:
|
|
print(f"⚠️ MODERATE RISK: {death_ratio*100:.2f}% death ratio")
|
|
else:
|
|
print(f"✓ ACCEPTABLE RISK: {death_ratio*100:.2f}% death ratio")
|
|
```
|
|
|
|
### Pattern 4: Literature Evidence Scoring
|
|
```python
|
|
# Score repurposing candidate by literature evidence
|
|
drug = "metformin"
|
|
disease = "cancer"
|
|
|
|
query = f"{drug} AND {disease}"
|
|
|
|
# Search multiple sources
|
|
pubmed = tu.tools.PubMed_search_articles(query=query, max_results=100)
|
|
pmc = tu.tools.EuropePMC_search_articles(query=query, limit=100)
|
|
trials = tu.tools.search_clinical_trials(condition=disease, intervention=drug)
|
|
|
|
# Count evidence types
|
|
review_count = sum(1 for p in pubmed.get('data', [])
|
|
if 'review' in p.get('title', '').lower())
|
|
rct_count = sum(1 for p in pubmed.get('data', [])
|
|
if 'randomized' in p.get('title', '').lower())
|
|
trial_count = len(trials.get('data', []))
|
|
|
|
# Calculate evidence score
|
|
evidence_score = (
|
|
len(pubmed.get('data', [])) * 1 + # 1 point per paper
|
|
review_count * 3 + # 3 points per review
|
|
rct_count * 5 + # 5 points per RCT
|
|
trial_count * 10 # 10 points per trial
|
|
)
|
|
|
|
print(f"Evidence Score: {evidence_score}")
|
|
print(f" Papers: {len(pubmed.get('data', []))}")
|
|
print(f" Reviews: {review_count}")
|
|
print(f" RCTs: {rct_count}")
|
|
print(f" Trials: {trial_count}")
|
|
```
|
|
|
|
---
|
|
|
|
## Troubleshooting
|
|
|
|
### Issue: "Disease not found"
|
|
**Solutions**:
|
|
1. Try disease synonyms
|
|
2. Use broader disease categories
|
|
3. Search OMIM or other disease databases
|
|
4. Use EFO ID directly if known
|
|
|
|
### Issue: "No drugs found for target"
|
|
**Causes**:
|
|
- Target not druggable
|
|
- Target name incorrect
|
|
- Limited database coverage
|
|
|
|
**Solutions**:
|
|
1. Check gene symbol (HUGO nomenclature)
|
|
2. Try protein name instead
|
|
3. Expand to pathway-level drugs
|
|
4. Check target druggability first
|
|
|
|
### Issue: "Drug name not recognized"
|
|
**Solutions**:
|
|
1. Try generic name (not brand)
|
|
2. Try different capitalization
|
|
3. Use DrugBank ID if known
|
|
4. Search PubChem first
|
|
|
|
### Issue: "API rate limits"
|
|
**Solutions**:
|
|
1. Enable caching: `use_cache=True`
|
|
2. Add delays between calls
|
|
3. Use batch operations
|
|
4. Register for API keys (NCBI, etc.)
|
|
|
|
### Issue: "Empty results for FAERS"
|
|
**Causes**:
|
|
- Drug name spelling
|
|
- Insufficient reports
|
|
- Wrong capitalization
|
|
|
|
**Solutions**:
|
|
1. Use UPPERCASE: "ASPIRIN" not "aspirin"
|
|
2. Try brand names
|
|
3. Check OpenFDA directly
|
|
|
|
### Issue: "Slow performance"
|
|
**Solutions**:
|
|
1. Enable caching globally
|
|
2. Limit result counts
|
|
3. Load specific tool categories
|
|
4. Use batch operations
|
|
5. Disable validation after testing
|
|
|
|
---
|
|
|
|
## Best Practices Summary
|
|
|
|
1. **Start with approved drugs** - Known safety profiles
|
|
2. **Validate across databases** - Cross-reference DrugBank, DGIdb, ChEMBL
|
|
3. **Check safety first** - FDA warnings before detailed analysis
|
|
4. **Use caching** - Save API calls and time
|
|
5. **Limit initial searches** - Expand only promising candidates
|
|
6. **Document evidence** - Keep track of supporting papers
|
|
7. **Consider mechanism** - Biological plausibility critical
|
|
8. **Assess patient populations** - Different from original indication
|
|
9. **Check IP landscape** - Patent status for new indications
|
|
10. **Think commercially** - Market size and unmet need
|
|
|
|
---
|
|
|
|
## Additional Resources
|
|
|
|
- **ToolUniverse Documentation**: https://zitniklab.hms.harvard.edu/ToolUniverse/
|
|
- **Tool Catalog**: https://zitniklab.hms.harvard.edu/ToolUniverse/tools/
|
|
- **DrugBank**: https://go.drugbank.com/
|
|
- **OpenTargets**: https://platform.opentargets.org/
|
|
- **ChEMBL**: https://www.ebi.ac.uk/chembl/
|
|
- **OpenFDA**: https://open.fda.gov/
|
|
- **PubMed**: https://pubmed.ncbi.nlm.nih.gov/
|